C24H38O8 — CID 122582585
1-[3-[2-[2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]ethanone (PubChem CID 122582585) has the molecular formula C24H38O8 and a molecular weight of 454.56 g/mol. Its IUPAC name is 1-[3-[2-[2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]ethanone.
| Compound Name | 1-[3-[2-[2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]ethanone |
|---|---|
| PubChem CID | 122582585 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-[3-[2-[2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(COCCOCCOCCOCCOCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C24H38O8/c1-21(25)23-6-4-5-22(19-23)20-30-16-15-28-12-11-26-9-10-27-13-14-29-17-18-32-24-7-2-3-8-31-24/h4-6,19,24H,2-3,7-18,20H2,1H3 |
| InChIKey | SZDWMPDXCYYHDS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|