C16H26O6 — CID 122547467
2-[2-[2-[2-(furan-2-ylmethoxy)ethoxy]ethoxy]ethoxy]oxane (PubChem CID 122547467) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[2-[2-[2-(furan-2-ylmethoxy)ethoxy]ethoxy]ethoxy]oxane.
| Compound Name | 2-[2-[2-[2-(furan-2-ylmethoxy)ethoxy]ethoxy]ethoxy]oxane |
|---|---|
| PubChem CID | 122547467 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-[2-[2-[2-(furan-2-ylmethoxy)ethoxy]ethoxy]ethoxy]oxane |
| SMILES | c1coc(COCCOCCOCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C16H26O6/c1-2-6-21-16(5-1)22-13-12-18-9-8-17-10-11-19-14-15-4-3-7-20-15/h3-4,7,16H,1-2,5-6,8-14H2 |
| InChIKey | RCAFURNADURYQY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|