C24H30O6 — CID 165391674
[4-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]-phenylmethanone (PubChem CID 165391674) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is [4-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]-phenylmethanone.
| Compound Name | [4-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 165391674 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [4-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(OCCOCCOCCOC2CCCCO2)cc1 |
| InChI | InChI=1S/C24H30O6/c25-24(20-6-2-1-3-7-20)21-9-11-22(12-10-21)28-18-16-26-14-15-27-17-19-30-23-8-4-5-13-29-23/h1-3,6-7,9-12,23H,4-5,8,13-19H2 |
| InChIKey | QORRQROIRKKHIT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|