About 2-(2-phenoxyethoxy)oxane
2-(2-phenoxyethoxy)oxane (PubChem CID 11736193) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-(2-phenoxyethoxy)oxane.
Molecular Properties
| Compound Name | 2-(2-phenoxyethoxy)oxane |
| PubChem CID | 11736193 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-(2-phenoxyethoxy)oxane |
| SMILES | c1ccc(OCCOC2CCCCO2)cc1 |
| InChI | InChI=1S/C13H18O3/c1-2-6-12(7-3-1)14-10-11-16-13-8-4-5-9-15-13/h1-3,6-7,13H,4-5,8-11H2 |
| InChIKey | CYZDNPQUMUMIQO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenoxyethoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenoxyethoxy)oxane?
The IUPAC name of 2-(2-phenoxyethoxy)oxane (CID 11736193) is 2-(2-phenoxyethoxy)oxane.
What is the SMILES notation for 2-(2-phenoxyethoxy)oxane?
The canonical SMILES for 2-(2-phenoxyethoxy)oxane is c1ccc(OCCOC2CCCCO2)cc1.
What is the InChIKey of 2-(2-phenoxyethoxy)oxane?
The InChIKey is CYZDNPQUMUMIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-2-6-12(7-3-1)14-10-11-16-13-8-4-5-9-15-13/h1-3,6-7,13H,4-5,8-11H2.
What are the key properties of 2-(2-phenoxyethoxy)oxane?
2-(2-phenoxyethoxy)oxane has a molecular weight of 222.28 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenoxyethoxy)oxane is sourced from PubChem (CID 11736193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).