C18H28O6 — CID 59552355
[3-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]methanol (PubChem CID 59552355) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [3-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]methanol.
| Compound Name | [3-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 59552355 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [3-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]phenyl]methanol |
| SMILES | OCc1cccc(OCCOCCOCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C18H28O6/c19-15-16-4-3-5-17(14-16)22-12-10-20-8-9-21-11-13-24-18-6-1-2-7-23-18/h3-5,14,18-19H,1-2,6-13,15H2 |
| InChIKey | WIAQFVUDDQOAGW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|