C47H56O11 — CID 159447558
methyl 4-methylbenzoate;1-(4-methylphenyl)-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]propane-1,3-dione;1-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]ethanone (PubChem CID 159447558) has the molecular formula C47H56O11 and a molecular weight of 796.95 g/mol. Its IUPAC name is methyl 4-methylbenzoate;1-(4-methylphenyl)-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]propane-1,3-dione;1-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]ethanone.
| Compound Name | methyl 4-methylbenzoate;1-(4-methylphenyl)-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]propane-1,3-dione;1-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 159447558 |
| Molecular Formula | C47H56O11 |
| Molecular Weight | 796.95 g/mol |
| Exact Mass | 796.38 |
| IUPAC Name | methyl 4-methylbenzoate;1-(4-methylphenyl)-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]propane-1,3-dione;1-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCOC2CCCCO2)cc1.COC(=O)c1ccc(C)cc1.Cc1ccc(C(=O)CC(=O)c2ccc(OCCOC3CCCCO3)cc2)cc1 |
| InChI | InChI=1S/C23H26O5.C15H20O4.C9H10O2/c1-17-5-7-18(8-6-17)21(24)16-22(25)19-9-11-20(12-10-19)26-14-15-28-23-4-2-3-13-27-23;1-12(16)13-5-7-14(8-6-13)17-10-11-19-15-4-2-3-9-18-15;1-7-3-5-8(6-4-7)9(10)11-2/h5-12,23H,2-4,13-16H2,1H3;5-8,15H,2-4,9-11H2,1H3;3-6H,1-2H3 |
| InChIKey | LSYJAXUHPGYWBB-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.95 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|