C16H21BrO5 — CID 90411719
methyl 4-bromo-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzoate (PubChem CID 90411719) has the molecular formula C16H21BrO5 and a molecular weight of 373.24 g/mol. Its IUPAC name is methyl 4-bromo-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzoate.
| Compound Name | methyl 4-bromo-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 90411719 |
| Molecular Formula | C16H21BrO5 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | methyl 4-bromo-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(Br)c(OCCOC2CCCCO2)c1C |
| InChI | InChI=1S/C16H21BrO5/c1-11-12(16(18)19-2)6-7-13(17)15(11)22-10-9-21-14-5-3-4-8-20-14/h6-7,14H,3-5,8-10H2,1-2H3 |
| InChIKey | AMGRUDHFZFREOJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|