C22H32BrNO7 — CID 177167876
methyl (2S)-3-[3-bromo-2-[2-(oxan-2-yloxy)ethoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 177167876) has the molecular formula C22H32BrNO7 and a molecular weight of 502.40 g/mol. Its IUPAC name is methyl (2S)-3-[3-bromo-2-[2-(oxan-2-yloxy)ethoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[3-bromo-2-[2-(oxan-2-yloxy)ethoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 177167876 |
| Molecular Formula | C22H32BrNO7 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | methyl (2S)-3-[3-bromo-2-[2-(oxan-2-yloxy)ethoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cccc(Br)c1OCCOC1CCCCO1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32BrNO7/c1-22(2,3)31-21(26)24-17(20(25)27-4)14-15-8-7-9-16(23)19(15)30-13-12-29-18-10-5-6-11-28-18/h7-9,17-18H,5-6,10-14H2,1-4H3,(H,24,26)/t17-,18?/m0/s1 |
| InChIKey | GHSSCCMSDPEHET-ZENAZSQFSA-N |
| XLogP | 3.98 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|