C22H33NO8 — CID 68619436
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-[2-[2-[(2R)-oxan-2-yl]oxyethoxy]ethoxy]phenyl]acetic acid (PubChem CID 68619436) has the molecular formula C22H33NO8 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-[2-[2-[(2R)-oxan-2-yl]oxyethoxy]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-[2-[2-[(2R)-oxan-2-yl]oxyethoxy]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 68619436 |
| Molecular Formula | C22H33NO8 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-[2-[2-[(2R)-oxan-2-yl]oxyethoxy]ethoxy]phenyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1ccc(OCCOCCO[C@@H]2CCCCO2)cc1 |
| InChI | InChI=1S/C22H33NO8/c1-22(2,3)31-21(26)23-19(20(24)25)16-7-9-17(10-8-16)28-14-12-27-13-15-30-18-6-4-5-11-29-18/h7-10,18-19H,4-6,11-15H2,1-3H3,(H,23,26)(H,24,25)/t18-,19?/m1/s1 |
| InChIKey | PMDLEOWOFJHPJH-MRTLOADZSA-N |
| XLogP | 3.28 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|