C16H22O6 — CID 102002140
methyl 4-[2-[2-(oxolan-2-yloxy)ethoxy]ethoxy]benzoate (PubChem CID 102002140) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 4-[2-[2-(oxolan-2-yloxy)ethoxy]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[2-(oxolan-2-yloxy)ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 102002140 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl 4-[2-[2-(oxolan-2-yloxy)ethoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOCCOC2CCCO2)cc1 |
| InChI | InChI=1S/C16H22O6/c1-18-16(17)13-4-6-14(7-5-13)20-11-9-19-10-12-22-15-3-2-8-21-15/h4-7,15H,2-3,8-12H2,1H3 |
| InChIKey | BHTNBRHAEDCULQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|