C19H26O5 — CID 122582493
methyl 4-[(E)-4-[2-(oxan-2-yloxy)ethoxy]but-1-enyl]benzoate (PubChem CID 122582493) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is methyl 4-[(E)-4-[2-(oxan-2-yloxy)ethoxy]but-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-4-[2-(oxan-2-yloxy)ethoxy]but-1-enyl]benzoate |
|---|---|
| PubChem CID | 122582493 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | methyl 4-[(E)-4-[2-(oxan-2-yloxy)ethoxy]but-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/CCOCCOC2CCCCO2)cc1 |
| InChI | InChI=1S/C19H26O5/c1-21-19(20)17-10-8-16(9-11-17)6-2-4-12-22-14-15-24-18-7-3-5-13-23-18/h2,6,8-11,18H,3-5,7,12-15H2,1H3/b6-2+ |
| InChIKey | YLPBOXXEPYXENB-QHHAFSJGSA-N |
| XLogP | 3.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|