C27H48O12 — CID 54155676
bis[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl] 2,2-dimethylpropanedioate (PubChem CID 54155676) has the molecular formula C27H48O12 and a molecular weight of 564.67 g/mol. Its IUPAC name is bis[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl] 2,2-dimethylpropanedioate.
| Compound Name | bis[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl] 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 54155676 |
| Molecular Formula | C27H48O12 |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | bis[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl] 2,2-dimethylpropanedioate |
| SMILES | CC(C)(C(=O)OCCOCCOCCOC1CCCCO1)C(=O)OCCOCCOCCOC1CCCCO1 |
| InChI | InChI=1S/C27H48O12/c1-27(2,25(28)38-21-17-32-13-11-30-15-19-36-23-7-3-5-9-34-23)26(29)39-22-18-33-14-12-31-16-20-37-24-8-4-6-10-35-24/h23-24H,3-22H2,1-2H3 |
| InChIKey | OKWHXALSILXSJB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|