About 2-(oxan-2-yloxy)ethyl propaneperoxoate
2-(oxan-2-yloxy)ethyl propaneperoxoate (PubChem CID 91031112) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)ethyl propaneperoxoate.
Molecular Properties
| Compound Name | 2-(oxan-2-yloxy)ethyl propaneperoxoate |
| PubChem CID | 91031112 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-(oxan-2-yloxy)ethyl propaneperoxoate |
| SMILES | CCC(=O)OOCCOC1CCCCO1 |
| InChI | InChI=1S/C10H18O5/c1-2-9(11)15-14-8-7-13-10-5-3-4-6-12-10/h10H,2-8H2,1H3 |
| InChIKey | IZPSEAAQXAMURE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxan-2-yloxy)ethyl propaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-2-yloxy)ethyl propaneperoxoate?
The IUPAC name of 2-(oxan-2-yloxy)ethyl propaneperoxoate (CID 91031112) is 2-(oxan-2-yloxy)ethyl propaneperoxoate.
What is the SMILES notation for 2-(oxan-2-yloxy)ethyl propaneperoxoate?
The canonical SMILES for 2-(oxan-2-yloxy)ethyl propaneperoxoate is CCC(=O)OOCCOC1CCCCO1.
What is the InChIKey of 2-(oxan-2-yloxy)ethyl propaneperoxoate?
The InChIKey is IZPSEAAQXAMURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-2-9(11)15-14-8-7-13-10-5-3-4-6-12-10/h10H,2-8H2,1H3.
What are the key properties of 2-(oxan-2-yloxy)ethyl propaneperoxoate?
2-(oxan-2-yloxy)ethyl propaneperoxoate has a molecular weight of 218.25 g/mol, XLogP of 1.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-2-yloxy)ethyl propaneperoxoate is sourced from PubChem (CID 91031112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).