C15H20BrNO6 — CID 123373152
methyl 3-(2-bromo-4,5-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 123373152) has the molecular formula C15H20BrNO6 and a molecular weight of 390.23 g/mol. Its IUPAC name is methyl 3-(2-bromo-4,5-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-(2-bromo-4,5-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 123373152 |
| Molecular Formula | C15H20BrNO6 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl 3-(2-bromo-4,5-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(Cc1cc(O)c(O)cc1Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20BrNO6/c1-15(2,3)23-14(21)17-10(13(20)22-4)5-8-6-11(18)12(19)7-9(8)16/h6-7,10,18-19H,5H2,1-4H3,(H,17,21) |
| InChIKey | UBYFOZVBMYTEHM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|