C14H16Br2ClNO5 — CID 170881274
3-(3,5-dibromo-4-chloro-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170881274) has the molecular formula C14H16Br2ClNO5 and a molecular weight of 473.55 g/mol. Its IUPAC name is 3-(3,5-dibromo-4-chloro-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(3,5-dibromo-4-chloro-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170881274 |
| Molecular Formula | C14H16Br2ClNO5 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 470.91 |
| IUPAC Name | 3-(3,5-dibromo-4-chloro-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(Br)c(Cl)c(Br)c1O)C(=O)O |
| InChI | InChI=1S/C14H16Br2ClNO5/c1-14(2,3)23-13(22)18-8(12(20)21)5-6-4-7(15)10(17)9(16)11(6)19/h4,8,19H,5H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | OQIXJZRXJHPCIM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|