C14H16Cl3NO4 — CID 170880720
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,5-trichlorophenyl)propanoic acid (PubChem CID 170880720) has the molecular formula C14H16Cl3NO4 and a molecular weight of 368.64 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,5-trichlorophenyl)propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,5-trichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 170880720 |
| Molecular Formula | C14H16Cl3NO4 |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,5-trichlorophenyl)propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(Cl)cc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C14H16Cl3NO4/c1-14(2,3)22-13(21)18-10(12(19)20)5-7-4-8(15)6-9(16)11(7)17/h4,6,10H,5H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | XAAMOBJHOPSPSP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|