C22H35BrN2O4 — CID 90408011
4-bromo-N'-(2,2-dimethylpentan-3-yl)-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzohydrazide (PubChem CID 90408011) has the molecular formula C22H35BrN2O4 and a molecular weight of 471.44 g/mol. Its IUPAC name is 4-bromo-N'-(2,2-dimethylpentan-3-yl)-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzohydrazide.
| Compound Name | 4-bromo-N'-(2,2-dimethylpentan-3-yl)-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzohydrazide |
|---|---|
| PubChem CID | 90408011 |
| Molecular Formula | C22H35BrN2O4 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-bromo-N'-(2,2-dimethylpentan-3-yl)-2-methyl-3-[2-(oxan-2-yloxy)ethoxy]benzohydrazide |
| SMILES | CCC(NNC(=O)c1ccc(Br)c(OCCOC2CCCCO2)c1C)C(C)(C)C |
| InChI | InChI=1S/C22H35BrN2O4/c1-6-18(22(3,4)5)24-25-21(26)16-10-11-17(23)20(15(16)2)29-14-13-28-19-9-7-8-12-27-19/h10-11,18-19,24H,6-9,12-14H2,1-5H3,(H,25,26) |
| InChIKey | KCISGZVLUMOMDV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|