C20H19F3O3 — CID 139900857
[2-(oxan-2-yloxymethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 139900857) has the molecular formula C20H19F3O3 and a molecular weight of 364.36 g/mol. Its IUPAC name is [2-(oxan-2-yloxymethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-(oxan-2-yloxymethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 139900857 |
| Molecular Formula | C20H19F3O3 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [2-(oxan-2-yloxymethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)c1ccccc1COC1CCCCO1 |
| InChI | InChI=1S/C20H19F3O3/c21-20(22,23)16-8-5-7-14(12-16)19(24)17-9-2-1-6-15(17)13-26-18-10-3-4-11-25-18/h1-2,5-9,12,18H,3-4,10-11,13H2 |
| InChIKey | XTCWTPHKPZXZNB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |