C20H18F4O3 — CID 101154322
[4-fluoro-3-(trifluoromethyl)phenyl]-[2-(oxan-2-yloxymethyl)phenyl]methanone (PubChem CID 101154322) has the molecular formula C20H18F4O3 and a molecular weight of 382.35 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl]-[2-(oxan-2-yloxymethyl)phenyl]methanone.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl]-[2-(oxan-2-yloxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 101154322 |
| Molecular Formula | C20H18F4O3 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl]-[2-(oxan-2-yloxymethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(F)c(C(F)(F)F)c1)c1ccccc1COC1CCCCO1 |
| InChI | InChI=1S/C20H18F4O3/c21-17-9-8-13(11-16(17)20(22,23)24)19(25)15-6-2-1-5-14(15)12-27-18-7-3-4-10-26-18/h1-2,5-6,8-9,11,18H,3-4,7,10,12H2 |
| InChIKey | MIGLDBRJTYDKHN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |