C13H18N2O3 — CID 131748739
N'-hydroxy-2-(oxan-2-yloxymethyl)benzenecarboximidamide (PubChem CID 131748739) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N'-hydroxy-2-(oxan-2-yloxymethyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-(oxan-2-yloxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 131748739 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N'-hydroxy-2-(oxan-2-yloxymethyl)benzenecarboximidamide |
| SMILES | NC(=NO)c1ccccc1COC1CCCCO1 |
| InChI | InChI=1S/C13H18N2O3/c14-13(15-16)11-6-2-1-5-10(11)9-18-12-7-3-4-8-17-12/h1-2,5-6,12,16H,3-4,7-9H2,(H2,14,15) |
| InChIKey | XNVCUAGGSOPNRC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|