C17H20N2O4 — CID 123146108
2-(furan-2-yl)-N'-hydroxy-4-(oxan-2-yloxymethyl)benzenecarboximidamide (PubChem CID 123146108) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-hydroxy-4-(oxan-2-yloxymethyl)benzenecarboximidamide.
| Compound Name | 2-(furan-2-yl)-N'-hydroxy-4-(oxan-2-yloxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 123146108 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(furan-2-yl)-N'-hydroxy-4-(oxan-2-yloxymethyl)benzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(COC2CCCCO2)cc1-c1ccco1 |
| InChI | InChI=1S/C17H20N2O4/c18-17(19-20)13-7-6-12(10-14(13)15-4-3-9-21-15)11-23-16-5-1-2-8-22-16/h3-4,6-7,9-10,16,20H,1-2,5,8,11H2,(H2,18,19) |
| InChIKey | GJLWFQMPIJXPAC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|