C17H23F3O3 — CID 164669225
2-methyl-4-(oxan-2-yloxy)-1-[3-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 164669225) has the molecular formula C17H23F3O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-methyl-4-(oxan-2-yloxy)-1-[3-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | 2-methyl-4-(oxan-2-yloxy)-1-[3-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 164669225 |
| Molecular Formula | C17H23F3O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-methyl-4-(oxan-2-yloxy)-1-[3-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CC(CCOC1CCCCO1)C(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3O3/c1-12(8-10-23-15-7-2-3-9-22-15)16(21)13-5-4-6-14(11-13)17(18,19)20/h4-6,11-12,15-16,21H,2-3,7-10H2,1H3 |
| InChIKey | CINPYCBMACKMRM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |