C15H20Cl2O2 — CID 57302396
2-[3-(3,4-dichlorophenyl)butoxy]oxane (PubChem CID 57302396) has the molecular formula C15H20Cl2O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)butoxy]oxane.
| Compound Name | 2-[3-(3,4-dichlorophenyl)butoxy]oxane |
|---|---|
| PubChem CID | 57302396 |
| Molecular Formula | C15H20Cl2O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)butoxy]oxane |
| SMILES | CC(CCOC1CCCCO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2O2/c1-11(12-5-6-13(16)14(17)10-12)7-9-19-15-4-2-3-8-18-15/h5-6,10-11,15H,2-4,7-9H2,1H3 |
| InChIKey | WVFOZZRBGBHFOW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |