C16H22Cl2O2S — CID 2794924
2-[4-[(3,4-dichlorophenyl)methylsulfanyl]butoxy]oxane (PubChem CID 2794924) has the molecular formula C16H22Cl2O2S and a molecular weight of 349.32 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)methylsulfanyl]butoxy]oxane.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)methylsulfanyl]butoxy]oxane |
|---|---|
| PubChem CID | 2794924 |
| Molecular Formula | C16H22Cl2O2S |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)methylsulfanyl]butoxy]oxane |
| SMILES | Clc1ccc(CSCCCCOC2CCCCO2)cc1Cl |
| InChI | InChI=1S/C16H22Cl2O2S/c17-14-7-6-13(11-15(14)18)12-21-10-4-3-9-20-16-5-1-2-8-19-16/h6-7,11,16H,1-5,8-10,12H2 |
| InChIKey | GOGXMMDKEWLTBV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|