C18H22F6N2O3 — CID 126674175
2-[3,5-bis(trifluoromethyl)phenyl]-5-(oxan-2-yloxy)pentanehydrazide (PubChem CID 126674175) has the molecular formula C18H22F6N2O3 and a molecular weight of 428.37 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-5-(oxan-2-yloxy)pentanehydrazide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5-(oxan-2-yloxy)pentanehydrazide |
|---|---|
| PubChem CID | 126674175 |
| Molecular Formula | C18H22F6N2O3 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5-(oxan-2-yloxy)pentanehydrazide |
| SMILES | NNC(=O)C(CCCOC1CCCCO1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H22F6N2O3/c19-17(20,21)12-8-11(9-13(10-12)18(22,23)24)14(16(27)26-25)4-3-7-29-15-5-1-2-6-28-15/h8-10,14-15H,1-7,25H2,(H,26,27) |
| InChIKey | XYWKHVVONLRLTF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|