C18H36N4O4 — CID 59422079
N,N'-bis(2-aminoethyl)-2-[6-(oxan-2-yloxy)hexyl]propanediamide (PubChem CID 59422079) has the molecular formula C18H36N4O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is N,N'-bis(2-aminoethyl)-2-[6-(oxan-2-yloxy)hexyl]propanediamide.
| Compound Name | N,N'-bis(2-aminoethyl)-2-[6-(oxan-2-yloxy)hexyl]propanediamide |
|---|---|
| PubChem CID | 59422079 |
| Molecular Formula | C18H36N4O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | N,N'-bis(2-aminoethyl)-2-[6-(oxan-2-yloxy)hexyl]propanediamide |
| SMILES | NCCNC(=O)C(CCCCCCOC1CCCCO1)C(=O)NCCN |
| InChI | InChI=1S/C18H36N4O4/c19-9-11-21-17(23)15(18(24)22-12-10-20)7-3-1-2-5-13-25-16-8-4-6-14-26-16/h15-16H,1-14,19-20H2,(H,21,23)(H,22,24) |
| InChIKey | CLOYJKNPKGLZSK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|