About 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate
6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate (PubChem CID 171652278) has the molecular formula C31H61NO4
and a molecular weight of 511.83 g/mol. Its IUPAC name is 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate.
Molecular Properties
| Compound Name | 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate |
| PubChem CID | 171652278 |
| Molecular Formula | C31H61NO4 |
| Molecular Weight | 511.83 g/mol |
| Exact Mass | 511.46 |
| IUPAC Name | 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCNCCCCOC1CCCCO1 |
| InChI | InChI=1S/C31H61NO4/c1-3-5-7-9-10-14-22-29(21-13-8-6-4-2)31(33)36-28-18-12-11-16-24-32-25-17-20-27-35-30-23-15-19-26-34-30/h29-30,32H,3-28H2,1-2H3 |
| InChIKey | PNKNILFBAJVFJN-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.83 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate?
The IUPAC name of 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate (CID 171652278) is 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate.
What is the SMILES notation for 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate?
The canonical SMILES for 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate is CCCCCCCCC(CCCCCC)C(=O)OCCCCCCNCCCCOC1CCCCO1.
What is the InChIKey of 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate?
The InChIKey is PNKNILFBAJVFJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H61NO4/c1-3-5-7-9-10-14-22-29(21-13-8-6-4-2)31(33)36-28-18-12-11-16-24-32-25-17-20-27-35-30-23-15-19-26-34-30/h29-30,32H,3-28H2,1-2H3.
What are the key properties of 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate?
6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate has a molecular weight of 511.83 g/mol, XLogP of 8.34, 26 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(oxan-2-yloxy)butylamino]hexyl 2-hexyldecanoate is sourced from PubChem (CID 171652278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).