C21H46N4O4 — CID 143167639
N-(2-aminoethyl)-2-formyl-8-(oxan-2-yloxy)octanamide;ethane;N'-methylethane-1,2-diamine (PubChem CID 143167639) has the molecular formula C21H46N4O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-formyl-8-(oxan-2-yloxy)octanamide;ethane;N'-methylethane-1,2-diamine.
| Compound Name | N-(2-aminoethyl)-2-formyl-8-(oxan-2-yloxy)octanamide;ethane;N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 143167639 |
| Molecular Formula | C21H46N4O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.35 |
| IUPAC Name | N-(2-aminoethyl)-2-formyl-8-(oxan-2-yloxy)octanamide;ethane;N'-methylethane-1,2-diamine |
| SMILES | CC.CNCCN.NCCNC(=O)C(C=O)CCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C16H30N2O4.C3H10N2.C2H6/c17-9-10-18-16(20)14(13-19)7-3-1-2-5-11-21-15-8-4-6-12-22-15;1-5-3-2-4;1-2/h13-15H,1-12,17H2,(H,18,20);5H,2-4H2,1H3;1-2H3 |
| InChIKey | TYUSBANEYAAHHH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|