C17H23F3N2O3 — CID 142606883
6-(oxan-2-yloxy)-2-(2,3,4-trifluorophenyl)hexanehydrazide (PubChem CID 142606883) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is 6-(oxan-2-yloxy)-2-(2,3,4-trifluorophenyl)hexanehydrazide.
| Compound Name | 6-(oxan-2-yloxy)-2-(2,3,4-trifluorophenyl)hexanehydrazide |
|---|---|
| PubChem CID | 142606883 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 6-(oxan-2-yloxy)-2-(2,3,4-trifluorophenyl)hexanehydrazide |
| SMILES | NNC(=O)C(CCCCOC1CCCCO1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H23F3N2O3/c18-13-8-7-11(15(19)16(13)20)12(17(23)22-21)5-1-3-9-24-14-6-2-4-10-25-14/h7-8,12,14H,1-6,9-10,21H2,(H,22,23) |
| InChIKey | NPMFDSXQICZOLX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|