C16H17BrF3N3O3 — CID 156579553
[5-bromo-2-[2-(oxan-2-yloxy)ethyl]-1,2,4-triazol-3-yl]-(2,3,4-trifluorophenyl)methanol (PubChem CID 156579553) has the molecular formula C16H17BrF3N3O3 and a molecular weight of 436.23 g/mol. Its IUPAC name is [5-bromo-2-[2-(oxan-2-yloxy)ethyl]-1,2,4-triazol-3-yl]-(2,3,4-trifluorophenyl)methanol.
| Compound Name | [5-bromo-2-[2-(oxan-2-yloxy)ethyl]-1,2,4-triazol-3-yl]-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 156579553 |
| Molecular Formula | C16H17BrF3N3O3 |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | [5-bromo-2-[2-(oxan-2-yloxy)ethyl]-1,2,4-triazol-3-yl]-(2,3,4-trifluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1F)c1nc(Br)nn1CCOC1CCCCO1 |
| InChI | InChI=1S/C16H17BrF3N3O3/c17-16-21-15(14(24)9-4-5-10(18)13(20)12(9)19)23(22-16)6-8-26-11-3-1-2-7-25-11/h4-5,11,14,24H,1-3,6-8H2 |
| InChIKey | KZNVHTKDGFHIMA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|