C20H29BrF2N4O3 — CID 163396242
5-bromo-N-(3,5-difluorophenyl)-2-(methoxymethyl)-N-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-amine;ethane (PubChem CID 163396242) has the molecular formula C20H29BrF2N4O3 and a molecular weight of 491.38 g/mol. Its IUPAC name is 5-bromo-N-(3,5-difluorophenyl)-2-(methoxymethyl)-N-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-amine;ethane.
| Compound Name | 5-bromo-N-(3,5-difluorophenyl)-2-(methoxymethyl)-N-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-amine;ethane |
|---|---|
| PubChem CID | 163396242 |
| Molecular Formula | C20H29BrF2N4O3 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-bromo-N-(3,5-difluorophenyl)-2-(methoxymethyl)-N-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-amine;ethane |
| SMILES | CC.COCn1nc(Br)nc1N(CCCOC1CCCCO1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H23BrF2N4O3.C2H6/c1-26-12-25-18(22-17(19)23-25)24(15-10-13(20)9-14(21)11-15)6-4-8-28-16-5-2-3-7-27-16;1-2/h9-11,16H,2-8,12H2,1H3;1-2H3 |
| InChIKey | JOHLTMLZDWZBRA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|