C19H28FNO3 — CID 100668376
4-[(2-fluorophenyl)methoxy]-1-[2-[(2R)-oxan-2-yl]oxyethyl]piperidine (PubChem CID 100668376) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methoxy]-1-[2-[(2R)-oxan-2-yl]oxyethyl]piperidine.
| Compound Name | 4-[(2-fluorophenyl)methoxy]-1-[2-[(2R)-oxan-2-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 100668376 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 4-[(2-fluorophenyl)methoxy]-1-[2-[(2R)-oxan-2-yl]oxyethyl]piperidine |
| SMILES | Fc1ccccc1COC1CCN(CCO[C@@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C19H28FNO3/c20-18-6-2-1-5-16(18)15-24-17-8-10-21(11-9-17)12-14-23-19-7-3-4-13-22-19/h1-2,5-6,17,19H,3-4,7-15H2/t19-/m1/s1 |
| InChIKey | MRPTWLNNNMBSHF-LJQANCHMSA-N |
| XLogP | 3.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |