C19H26O5 — CID 164537921
ethyl 2-[3-[3-(oxan-2-yloxymethyl)phenyl]oxetan-3-yl]acetate (PubChem CID 164537921) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethyl 2-[3-[3-(oxan-2-yloxymethyl)phenyl]oxetan-3-yl]acetate.
| Compound Name | ethyl 2-[3-[3-(oxan-2-yloxymethyl)phenyl]oxetan-3-yl]acetate |
|---|---|
| PubChem CID | 164537921 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | ethyl 2-[3-[3-(oxan-2-yloxymethyl)phenyl]oxetan-3-yl]acetate |
| SMILES | CCOC(=O)CC1(c2cccc(COC3CCCCO3)c2)COC1 |
| InChI | InChI=1S/C19H26O5/c1-2-22-17(20)11-19(13-21-14-19)16-7-5-6-15(10-16)12-24-18-8-3-4-9-23-18/h5-7,10,18H,2-4,8-9,11-14H2,1H3 |
| InChIKey | IQKUGJVDCDHUPL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |