C15H22BO2 — CID 71106654
CID 71106654 (PubChem CID 71106654) has the molecular formula C15H22BO2 and a molecular weight of 245.15 g/mol.
| Compound Name | CID 71106654 |
|---|---|
| PubChem CID | 71106654 |
| Molecular Formula | C15H22BO2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | — |
| SMILES | C[B]c1cccc(CCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C15H22BO2/c1-16-14-8-4-6-13(12-14)7-5-11-18-15-9-2-3-10-17-15/h4,6,8,12,15H,2-3,5,7,9-11H2,1H3 |
| InChIKey | CQZKUILYFTUGOU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|