C20H28O4 — CID 10042403
(E)-6-[3-[3-(oxan-2-yloxy)propyl]phenyl]hex-5-enoic acid (PubChem CID 10042403) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (E)-6-[3-[3-(oxan-2-yloxy)propyl]phenyl]hex-5-enoic acid.
| Compound Name | (E)-6-[3-[3-(oxan-2-yloxy)propyl]phenyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 10042403 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (E)-6-[3-[3-(oxan-2-yloxy)propyl]phenyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/c1cccc(CCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C20H28O4/c21-19(22)12-3-1-2-8-17-9-6-10-18(16-17)11-7-15-24-20-13-4-5-14-23-20/h2,6,8-10,16,20H,1,3-5,7,11-15H2,(H,21,22)/b8-2+ |
| InChIKey | NVQLHQVRKSONTH-KRXBUXKQSA-N |
| XLogP | 4.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|