C19H20FNO4 — CID 163392692
6-[3-(4-fluorophenoxy)propyl]-N-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 163392692) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is 6-[3-(4-fluorophenoxy)propyl]-N-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | 6-[3-(4-fluorophenoxy)propyl]-N-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 163392692 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 6-[3-(4-fluorophenoxy)propyl]-N-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | O=C(NO)C1CCc2cc(CCCOc3ccc(F)cc3)ccc2O1 |
| InChI | InChI=1S/C19H20FNO4/c20-15-5-7-16(8-6-15)24-11-1-2-13-3-9-17-14(12-13)4-10-18(25-17)19(22)21-23/h3,5-9,12,18,23H,1-2,4,10-11H2,(H,21,22) |
| InChIKey | ZCAIJEDWCWSDRQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|