C12H17O3P — CID 143613113
ethane;6-phosphanyl-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 143613113) has the molecular formula C12H17O3P and a molecular weight of 240.24 g/mol. Its IUPAC name is ethane;6-phosphanyl-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | ethane;6-phosphanyl-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 143613113 |
| Molecular Formula | C12H17O3P |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | ethane;6-phosphanyl-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | CC.O=C(O)C1CCc2cc(P)ccc2O1 |
| InChI | InChI=1S/C10H11O3P.C2H6/c11-10(12)9-3-1-6-5-7(14)2-4-8(6)13-9;1-2/h2,4-5,9H,1,3,14H2,(H,11,12);1-2H3 |
| InChIKey | YNQDCCPDGVNXHU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|