C10H9O4- — CID 21283842
6-hydroxy-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 21283842) has the molecular formula C10H9O4- and a molecular weight of 193.18 g/mol. Its IUPAC name is 6-hydroxy-3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | 6-hydroxy-3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 21283842 |
| Molecular Formula | C10H9O4- |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 6-hydroxy-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | O=C([O-])C1CCc2cc(O)ccc2O1 |
| InChI | InChI=1S/C10H10O4/c11-7-2-4-8-6(5-7)1-3-9(14-8)10(12)13/h2,4-5,9,11H,1,3H2,(H,12,13)/p-1 |
| InChIKey | OEPFJOJFTVSOOI-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |