C11H12O4 — CID 70048394
(2S)-6-methoxy-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 70048394) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (2S)-6-methoxy-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | (2S)-6-methoxy-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 70048394 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (2S)-6-methoxy-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | COc1ccc2c(c1)CC[C@@H](C(=O)O)O2 |
| InChI | InChI=1S/C11H12O4/c1-14-8-3-5-9-7(6-8)2-4-10(15-9)11(12)13/h3,5-6,10H,2,4H2,1H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | TYIMOLJFMUBRTB-JTQLQIEISA-N |
| XLogP | 1.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |