C11H13FO3 — CID 174629306
2-[[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]oxy]ethanol (PubChem CID 174629306) has the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-[[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]oxy]ethanol.
| Compound Name | 2-[[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 174629306 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-[[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]oxy]ethanol |
| SMILES | OCCO[C@H]1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C11H13FO3/c12-9-2-3-10-8(7-9)1-4-11(15-10)14-6-5-13/h2-3,7,11,13H,1,4-6H2/t11-/m1/s1 |
| InChIKey | GMBXSJHUZKIZPM-LLVKDONJSA-N |
| XLogP | 1.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |