C11H15NO3 — CID 142030949
2-methyl-2,3-dihydro-1-benzofuran-5-amine;methyl formate (PubChem CID 142030949) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1-benzofuran-5-amine;methyl formate.
| Compound Name | 2-methyl-2,3-dihydro-1-benzofuran-5-amine;methyl formate |
|---|---|
| PubChem CID | 142030949 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-methyl-2,3-dihydro-1-benzofuran-5-amine;methyl formate |
| SMILES | CC1Cc2cc(N)ccc2O1.COC=O |
| InChI | InChI=1S/C9H11NO.C2H4O2/c1-6-4-7-5-8(10)2-3-9(7)11-6;1-4-2-3/h2-3,5-6H,4,10H2,1H3;2H,1H3 |
| InChIKey | UDKKDANIWYXFCA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|