C10H12N2O — CID 168530150
(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine (PubChem CID 168530150) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine.
| Compound Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine |
|---|---|
| PubChem CID | 168530150 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine |
| SMILES | CC1Cc2cc(C=NN)ccc2O1 |
| InChI | InChI=1S/C10H12N2O/c1-7-4-9-5-8(6-12-11)2-3-10(9)13-7/h2-3,5-7H,4,11H2,1H3 |
| InChIKey | UPUCRUJSQPSIEZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|