C12H16O — CID 143125132
6-ethyl-2-methyl-3,4-dihydro-2H-chromene (PubChem CID 143125132) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-ethyl-2-methyl-3,4-dihydro-2H-chromene.
| Compound Name | 6-ethyl-2-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 143125132 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 6-ethyl-2-methyl-3,4-dihydro-2H-chromene |
| SMILES | CCc1ccc2c(c1)CCC(C)O2 |
| InChI | InChI=1S/C12H16O/c1-3-10-5-7-12-11(8-10)6-4-9(2)13-12/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | XMNFJEUWDNHFEL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |