C10H15NO — CID 174522322
azane;(2R)-2-methyl-3,4-dihydro-2H-chromene (PubChem CID 174522322) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is azane;(2R)-2-methyl-3,4-dihydro-2H-chromene.
| Compound Name | azane;(2R)-2-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 174522322 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | azane;(2R)-2-methyl-3,4-dihydro-2H-chromene |
| SMILES | C[C@@H]1CCc2ccccc2O1.N |
| InChI | InChI=1S/C10H12O.H3N/c1-8-6-7-9-4-2-3-5-10(9)11-8;/h2-5,8H,6-7H2,1H3;1H3/t8-;/m1./s1 |
| InChIKey | JXPDYSDQCQLVLL-DDWIOCJRSA-N |
| XLogP | 2.56 |
| TPSA | 44.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |