C13H22O — CID 91201191
ethane;2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 91201191) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | ethane;2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 91201191 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | ethane;2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CC.CC.CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C9H10O.2C2H6/c1-7-6-8-4-2-3-5-9(8)10-7;2*1-2/h2-5,7H,6H2,1H3;2*1-2H3 |
| InChIKey | GDBKFJSXJOWFFC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |