C14H22O2 — CID 142100013
ethane;2-methyl-2,3-dihydrochromen-4-one (PubChem CID 142100013) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;2-methyl-2,3-dihydrochromen-4-one.
| Compound Name | ethane;2-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 142100013 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethane;2-methyl-2,3-dihydrochromen-4-one |
| SMILES | CC.CC.CC1CC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C10H10O2.2C2H6/c1-7-6-9(11)8-4-2-3-5-10(8)12-7;2*1-2/h2-5,7H,6H2,1H3;2*1-2H3 |
| InChIKey | XISOSKYWMJYCRI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |