C10H9FO2 — CID 7016138
(2S)-6-fluoro-2-methyl-2,3-dihydrochromen-4-one (PubChem CID 7016138) has the molecular formula C10H9FO2 and a molecular weight of 180.18 g/mol. Its IUPAC name is (2S)-6-fluoro-2-methyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-6-fluoro-2-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 7016138 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2S)-6-fluoro-2-methyl-2,3-dihydrochromen-4-one |
| SMILES | C[C@H]1CC(=O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C10H9FO2/c1-6-4-9(12)8-5-7(11)2-3-10(8)13-6/h2-3,5-6H,4H2,1H3/t6-/m0/s1 |
| InChIKey | RPAIBTVEPAACRP-LURJTMIESA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |