C13H15FO2S — CID 114672037
2-(2-ethylsulfanylethyl)-6-fluoro-2,3-dihydrochromen-4-one (PubChem CID 114672037) has the molecular formula C13H15FO2S and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(2-ethylsulfanylethyl)-6-fluoro-2,3-dihydrochromen-4-one.
| Compound Name | 2-(2-ethylsulfanylethyl)-6-fluoro-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114672037 |
| Molecular Formula | C13H15FO2S |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-(2-ethylsulfanylethyl)-6-fluoro-2,3-dihydrochromen-4-one |
| SMILES | CCSCCC1CC(=O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C13H15FO2S/c1-2-17-6-5-10-8-12(15)11-7-9(14)3-4-13(11)16-10/h3-4,7,10H,2,5-6,8H2,1H3 |
| InChIKey | RDYYMFMOGLPYHL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|