C13H11FN2O2 — CID 114672192
6-fluoro-2-(1-methylpyrazol-4-yl)-2,3-dihydrochromen-4-one (PubChem CID 114672192) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is 6-fluoro-2-(1-methylpyrazol-4-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-fluoro-2-(1-methylpyrazol-4-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114672192 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 6-fluoro-2-(1-methylpyrazol-4-yl)-2,3-dihydrochromen-4-one |
| SMILES | Cn1cc(C2CC(=O)c3cc(F)ccc3O2)cn1 |
| InChI | InChI=1S/C13H11FN2O2/c1-16-7-8(6-15-16)13-5-11(17)10-4-9(14)2-3-12(10)18-13/h2-4,6-7,13H,5H2,1H3 |
| InChIKey | WFYXMUQBRCOLGL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |