C16H18N2O2 — CID 103573832
6-methyl-2-(1-propylpyrazol-4-yl)-2,3-dihydrochromen-4-one (PubChem CID 103573832) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 6-methyl-2-(1-propylpyrazol-4-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-methyl-2-(1-propylpyrazol-4-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 103573832 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 6-methyl-2-(1-propylpyrazol-4-yl)-2,3-dihydrochromen-4-one |
| SMILES | CCCn1cc(C2CC(=O)c3cc(C)ccc3O2)cn1 |
| InChI | InChI=1S/C16H18N2O2/c1-3-6-18-10-12(9-17-18)16-8-14(19)13-7-11(2)4-5-15(13)20-16/h4-5,7,9-10,16H,3,6,8H2,1-2H3 |
| InChIKey | PSVDDHSJKAPGES-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |